Shark liver alcohol intermediate. Universal solvent, plasticizer, pharmaceutical excipients (cosolve
Email: info@standard-groups.com
Package:210kg/drum or according to clients' requirements. Storage: in a dry and ventilated warehouse; keep away from sunshine; avoid fire; avoid moisture.
| Nama | Solketal |
| Sinonim | Solketal 1,2-dioxolane ISOPROPYLIDENGLYCEROL LABOTEST-BB LT00233172 ISOPROPYLIDENEGLYCEROL GLYCEROL DIMETHYLKETAL Acetone ketal of glycerine 2,3-O-ISOPROPYLIDENEGLYCEROL 1,2-Isopropylidene-rac-glycerol glycerol 1,2-isopropylidene ether DL-alpha,beta-Isopropylideneglycerol DL-ALPHA,BETA-ISOPROPYLIDENEGLYCEROL 2,2-DIMETHYL-1,3-DIOXOLANE-4-METHANOL 2,2-dimethyl-1,3-dioxolan-4-ylmethanol 4-hydroxymethyl-2,2-dimethyl-1,3-dioxolan (2,2-Dimethyl-1,3-dioxolan-4-yl)methanol [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (+,-)-2,2-Dimethyl-4-hydroxymethyl-1,3-dioxolane |
| CAS | 100-79-8 |
| EINECS | 202-888-7 |
| InChI | InChI=1/C6H12O3/c1-6(2)8-4-5(3-7)9-6/h5,7H,3-4H2,1-2H3/t5-/m0/s1 |
| InChIKey | RNVYQYLELCKWAN-UHFFFAOYSA-N |
| Rumus Molekuler | C6H12O3 |
| Massa Molar | 132.16 |
| Kepadatan | 1.066g/mLat 20°C(lit.) |
| Titik Melting | -27℃ |
| Titik Boling | 189-191°C |
| Titik Flash | 176°F |
| Kelarutan air | miscible |
| Solubilitas | 172g/l soluble |
| Tekanan Vapor | 34Pa at 20℃ |
| Penampilan | colorless liquid |
| warna | Kosongkan tanpa warna |
| Merck | 14,5213 |
| BRN | 104465 |
| pKa | 14.20±0.10(Predicted) |
| PH | 4.0-7.5 (H2O) |
| Kondisi penyimpanan | Sealed in dry,2-8°C |
| Indeks Refraksi | n20/D 1.434 |
| Sifat fisik dan kimia | Colorless liquid. Boiling point 82 ℃/1.3kPa(10mmHg),24 ℃/66.7 (0.5mmHg), density 1.064, refractive index 1.4383, flash point 90 ℃, with water, alcohol, Ester, ether, miscibility of aromatic hydrocarbons. |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
