white crystalline powder, mainly used in the pharmaceutical industry. Used in the synthesis of Chlor
Email:services@moutainchem.com
package: 1KG/bag; 25KG/drum or according to clients' requirements. Storage: in a dry and ventilated warehouse; keep away from sunshine and moisture.
| Nama | 3-Dimethylaminopropylchloride hydrochloride |
| Sinonim | 3-DMPC DMPC, HCl 3-Dimethylaminopropyl chloride HCL 3-Chloro-N,N-Dimethylpropylamine HCL 3-(DIMETHYLAMINO)-1-CHLORO-PROPANE HCL 3-chloro-N,N-dimethylpropan-1-aminium hcl 3-Dimethylaminopropylchloride hydrochloride 3-chloropropyldimethylammonium chloride hcl 3-DIMETHYLAMINOPROPYL CHLORIDE HYDROCHLORIDE 3-chloropropyldimethylammonium hydrochloride 3-Dimethylaminopropyl Chloride Hydrochloride 3-Dimethylaminorpopyl chloride hydrochloride 3-CHLORO-1-DIMETHYLAMINOPROPANE HYDROCHLORIDE 1-Chloro-3-dimethylaminopropane hydrochloride N-(3-chloropropyl)dimethylamine hydrochloride 3-Chloro-N,N-dimethylpropylamine hydrochloride N,N-DIMETHYL-3-CHLOROPROPYLAMINE hydrochloride 3-DIMETHYLAMINO-1-PROPYL CHLORIDE HYDROCHLORIDE N,N-DIMETHYLAMINO-3-CHLOROPROPANE HYDROCHLORIDE 1-(DIMETHYLAMINO)-3-CHLOROPROPANE HYDROCHLORIDE 3-Dimethylamino-1-propyl chloride hydrochloride N-(3-CHLOROPROPYL)-N,N-DIMETHYLAMMONIUM CHLORIDE 1-(N,N-DIMETHYLAMINO)-3-CHLORO PROPANE HYDROCHLORIDE 3-chloropropyldimethylammonium chloride hydrochloride |
| CAS | 1281-00-1 5407-04-5 |
| EINECS | 226-467-2 |
| InChI | InChI=1/C5H12ClN/c1-7(2)5-3-4-6/h3-5H2,1-2H3/p+1 |
| Rumus Molekuler | C5H13Cl2N |
| Massa Molar | 158.07 |
| Titik Melting | 140-143°C(lit.) |
| Titik Boling | 130.7°C at 760 mmHg |
| Titik Flash | 32.8°C |
| Kelarutan air | soluble |
| Tekanan Vapor | 9.61mmHg at 25°C |
| Penampilan | Kristal tanpa warna |
| warna | Putih hingga kuning |
| Kondisi penyimpanan | Suhu Kamar |
| MDL | MFCD00012521 |
| Sifat fisik dan kimia | Melting point 139-145°C water-soluble solution |
| Penggunaan | For the synthesis of chlorpromazine, doxepin hydrochloride, telden and other drugs |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
