Chemical Name: DL-3-Hydroxybutyric acid sodium salt CAS No.: 150-83-4Assay: ≥ 99.0% Appearance: Whit
Email: info@standard-groups.com
DL-3-Hydroxybutyric acid sodium salt Usage： Sodium 3-hydroxybutyrate can be directly used to produce aliphatic polyester plastics. It can also be combined with other compounds to produce plastics with excellent properties. DL-3-Hydroxybutyric acid sodium salt Packaging and Shipping： 25kg/ drum，25kg/bag or as per buyer requirement. DL-3-Hydroxybutyric acid sodium salt Storage： Store in a ventilated low-temperature dry warehouse;Store separately with oxidants, acids and alkali.
| Nama | 3-hydroxybutyric acid, sodium salt |
| Sinonim | Sodium 3-hydroxyburyrate Sodium 3-hydroxybutyrate sodium 3-hydroxybutanoate B-HydroxybutyricAcidSodiumSalt 3-HYDROXYBUTYRIC ACID SODIUM SALT DL-B-HYDROXYBUTYRICACIDSODIUMSALT 3-Hydroxybutyric acid sodium salt 3-hydroxybutyric acid, sodium salt Dl-3-Hydroxybutyric Acid Sodium Salt dl-β-hydroxybutyric acid sodium salt DL-beta-Hydroxybutyric acid sodium salt Butanoic acid, 3-hydroxy-, monosodium salt DL-B-HYDROXYBUTYRIC ACID SODIUM*CRYSTALL INE |
| CAS | 150-83-4 |
| EINECS | 205-774-5 |
| InChI | InChI=1/C4H8O3.Na/c1-3(5)2-4(6)7;/h3,5H,2H2,1H3,(H,6,7) |
| InChIKey | NBPUSGBJDWCHKC-UHFFFAOYSA-M |
| Rumus Molekuler | C4H7NaO3 |
| Massa Molar | 126.09 |
| Titik Melting | 167-170°C |
| Titik Boling | 269.2°C at 760 mmHg |
| Titik Flash | 121°C |
| Solubilitas | Methanol (Slightly, Sonicated), Water (Slightly) |
| Tekanan Vapor | 0.000979mmHg at 25°C |
| Penampilan | Bubuk kristal |
| warna | Putih |
| BRN | 4824866 |
| Kondisi penyimpanan | 2-8°C |
| Stabilitas | Higroskopis |
| Sensitif | Higroskopis |
| MDL | MFCD00016716 |
| In vitro study | 3-Hydroxybutyric acid sodium (β-Hydroxybutyric acid sodium) is capable of interacting with lipids (modeled using a DPPC monolayer) and altering phase behavior at clinical concentrations. 3-Hydroxybutyric acid sodium also diminishes the interfacial viscosity of DPPC Monolayers. |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
