Chemical Name: Oleic acidCAS No.: 112-80-1Assay: ≥99.0%Appearance: Colorless to yellowish oily liqui
Email: info@standard-groups.com
Oleic acid Usage： It is used to make soap, lubricant, flotation agent, ointment, oleate, etc. it is also a good solvent for fatty acids and oil soluble substances. Oleic acid Packaging and Shipping： 180KG/drum Oleic acid Storage: Stored in a dry and ventilated warehouse; keep away from sunshine; avoid fire; avoid moisture.
| Nama | Oleic acid |
| Sinonim | red oil oleoate Metaupon Oleic acid Oleic acid, AR Metal polish,red OmniPur Oleic Acid 9Octadecenoicacid(9Z) Polishing compound,red 9-cis-Octadecenoicacid cis-9-Octadecenoic acid 9-Octadecenoic acid, cis- Oleic acid CETEARYL ALCOHOL Manufacturer |
| CAS | 112-80-1 |
| EINECS | 204-007-1 |
| InChI | InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9- |
| InChIKey | ZQPPMHVWECSIRJ-KTKRTIGZSA-N |
| Rumus Molekuler | C18H34O2 |
| Massa Molar | 282.46 |
| Kepadatan | 0.89 g/mL at 25 °C(lit.) |
| Titik Melting | 13-14°C(lit.) |
| Titik Boling | 360 °C |
| Titik Flash | 133°F |
| Nomor JECFA | 333 |
| Kelarutan air | negligible |
| Solubilitas | Insoluble in water, miscible in alcohol and ether, soluble in benzene and chloroform |
| Tekanan Vapor | 52 mm Hg ( 37 °C) |
| Densitas Vapor | 1.03 (vs air) |
| Penampilan | oily |
| Gravitasi Spesifik | 0.892 (20/4℃) |
| warna | Colorless to pale yellow |
| Bau | Peculiar Lard-Like |
| Merck | 14,6828 |
| BRN | 1726542 |
| pKa | pKa 5.35(H2O,t =25) (Uncertain) |
| Kondisi penyimpanan | -20 ° C |
| Stabilitas | Stable. Combustible. Incompatible with strong oxidizing agents, aluminium. |
| Sensitif | Sensitif Udara |
| Indeks Refraksi | n20/D 1.377 |
| MDL | MFCD00064242 |
| Sifat fisik dan kimia | density 0.89 |
| Penggunaan | For soap, lubricants, flotation agent, ointment and oleate, etc. |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
