Chemical Name: 2-Chloro-1,4-naphthoquinoneCAS No.: 1010-60-2Assay: ≥99.0% Appearance: Yellow crystal
Email: info@standard-groups.com
2-Chloro-1,4-naphthoquinone Usage： Mainly used as pharmaceutical intermediates, atovaquone intermediates. 2-Chloro-1,4-naphthoquinone Packaging and Shipping： 25KG/drum or as per buyer requirement 2-Chloro-1,4-naphthoquinone Storage: Storage in ventilated low temperature dry warehouse; Keep container closed and separately from open flame and heat source.
| Nama | 2-chloro-1,4-Naphthoquinone |
| Sinonim | AURORA KA-5008 RARECHEM BW GC 0008 2-chloronaphthoquinone 2-Chloronaphthoquinone 2-chloro-4-naphthoquinone 2-CHLORO-1,4-NAPHTHOQUINONE 2-chloro-1,4-Naphthoquinone 1,4-Naphthoquinone, 2-chloro- 2-CHLORO-1,4-NAPHTHALENEDIONE 1,4-naphthoquinone, 2-chloro- 2-chloronaphthalene-1,4-dione 2-chloro-1,4-naphthalenedione 1,4-Naphthalenedione, 2-chloro- 1,4-naphthalenedione, 2-chloro- |
| CAS | 1010-60-2 |
| EINECS | 213-776-2 |
| InChI | InChI=1/C10H5ClO2/c11-8-5-9(12)6-3-1-2-4-7(6)10(8)13/h1-5H |
| InChIKey | CCTJHVLTAJTPBV-UHFFFAOYSA-N |
| Rumus Molekuler | C10H5ClO2 |
| Massa Molar | 192.6 |
| Kepadatan | 1.42±0.1 g/cm3(Predicted) |
| Titik Melting | 108-109°C |
| Titik Boling | 308.0±42.0 °C(Predicted) |
| Titik Flash | 129.3°C |
| Solubilitas | Chloroform (Slightly) |
| Tekanan Vapor | 0.000701mmHg at 25°C |
| Penampilan | Bubuk kristal |
| warna | Yellow to Dark Yellow |
| Panjang gelombang maksimum (λmax) | ['333nm(Hexane)(lit.)'] |
| Kondisi penyimpanan | Sealed in dry,2-8°C |
| Stabilitas | Kekerasan Sensitif |
| Indeks Refraksi | 1.625 |
| MDL | MFCD00029187 |
| Sifat fisik dan kimia | Melting Point: 119-122°C flash point: 141°C Appearance: yellowish |
| Penggunaan | Intermediate of atropine |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
