Chemical Name:DL-MethionineCAS No.:59-51-8Assay: ≥98.5%Appearance: White crystalline solid
Email: info@standard-groups.com
DL-Methionine Usage： As feed nutrition enhancer；Used as a biochemical reagent. DL-Methionine Packaging and Shipping： 25KG/drum or according to buyer's requirements. DL-Methionine Storage: Stored in a dry and ventilated warehouse; keep away from sunshine; avoid fire; avoid moisture.
| Nama | DL-Methionine |
| Sinonim | Neston Metione Urimeth Pedameth Petameth Thiomedon H-DL-Met-OH DL-Methionine DL-Methoionine (RS)-2-Amino-3-methylthiobutansαure DL-2-Amino-4-(methylthio)butyric acid (R,S)-2-Amino-4-methylsulfanyl-butyricacid |
| CAS | 59-51-8 |
| EINECS | 200-432-1 |
| InChI | InChI=1/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| InChIKey | FFEARJCKVFRZRR-UHFFFAOYSA-N |
| Rumus Molekuler | C5H11NO2S |
| Massa Molar | 149.21 |
| Kepadatan | 1.34 |
| Titik Melting | 284°C (dec.)(lit.) |
| Titik Boling | 306.9±37.0 °C(Predicted) |
| Rotasi Spesifik( α) | -1～+1°(D/20℃)(c=8,HCl) |
| Nomor JECFA | 1424 |
| Kelarutan air | 2.9 g/100 mL (20 ºC) |
| Solubilitas | Soluble in water, dilute acid and dilute alkali, slightly soluble in 95% alcohol, insoluble in ether |
| Penampilan | Bubuk kristal |
| warna | Putih |
| Merck | 14,5975 |
| BRN | 636185 |
| pKa | 2.13(at 25℃) |
| Kondisi penyimpanan | 2-8°C |
| Stabilitas | Stable. Incompatible with strong oxidising agents. |
| Sensitif | Sensitif untuk cahaya |
| Indeks Refraksi | 1.5216 (estimate) |
| MDL | MFCD00063096 |
| Sifat fisik dan kimia | White flaky crystal or crystalline powder. Special odor. The taste was slightly sweet. Melting point 281 degrees (decomposition). 10% pH of the aqueous solution 5.6-6.1. No optical rotation. Stable to heat and air. Unstable to strong acids, can lead to demethylation. Soluble in water (3.3g/100ml,25 degrees), dilute acid and dilute solution. Extremely insoluble in ethanol, almost insoluble in ether |
| Penggunaan | Used as a Biochemical reagent |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
