Chemical Name: 2,6-Dihydroxy-3-methylpurineCAS No.: 1076-22-8Assay: ≥98.0% Appearance: Light yellow
Email: info@standard-groups.com
2,6-Dihydroxy-3-methylpurine CAS 1076-22-8 Usage： Used as pharmaceutical intermediate 2,6-Dihydroxy-3-methylpurine CAS 1076-22-8 Packaging and Shipping： 25kgs/Bag or Drum or as required by buyer. 2,6-Dihydroxy-3-methylpurine CAS 1076-22-8 Storage: Store in a cool, ventilated place, protect from sun, heat and moisture.Storage and transportation according to general chemical regulations.
| Nama | 3-Methylxanthine |
| Sinonim | 3 MX CCRIS 5817 NSC 515466 AKOS NCG-0058 3-METHYLXANTHINE 3-Methylxanthine Xanthine, 3-methyl- 3-methyl-3H-purine-2,6-diol 3-METHYLXANTHINE CRYSTALLINE 3-methyl-7H-purine-2,6-dione 2,6-DIHYDROXY-3-METHYLPURINE 2,6-Dihydroxy-3-methylpurine 3-methyl-1H-purine-2,6(3H,7H)-dione 3-METHYLXANTHINE XANTHINE DERIVATIVE 3,7-Dihydro-3-methyl-1H-purine-2,6-dione 3,7-dihydro-3-methyl-1H-purine-2,6-dione 3-methyl-3,7-dihydro-1H-purine-2,6-dione 1H-Purine-2,6-dione, 3,7-dihydro-3-methyl- |
| CAS | 1076-22-8 |
| EINECS | 214-058-1 |
| InChI | InChI=1/C6H6N4O2/c1-10-4-3(7-2-8-4)5(11)9-6(10)12/h2,11H,1H3,(H,9,12) |
| InChIKey | GMSNIKWWOQHZGF-UHFFFAOYSA-N |
| Rumus Molekuler | C6H6N4O2 |
| Massa Molar | 166.14 |
| Kepadatan | 1.4434 (rough estimate) |
| Titik Melting | >300 °C (lit.) |
| Titik Boling | 294.33°C (rough estimate) |
| Titik Flash | 148.8°C |
| Kelarutan air | Tidak larut dalam air. |
| Solubilitas | DMSO (Slightly, Heated), Methanol (Slightly) |
| Tekanan Vapor | 2.23E-05mmHg at 25°C |
| Penampilan | White to cream solid |
| warna | Putih hingga Putih |
| BRN | 180944 |
| pKa | pK1:8.10;pK2:11.3 (25°C) |
| Kondisi penyimpanan | 2-8°C |
| Indeks Refraksi | 1.6700 (estimate) |
| MDL | MFCD00005580 |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
