Chemical Name: 4-Bromo-2-fluoroanisoleCAS No.: 2357-52-0Assay: ≥99.0% Appearance: colorless clear li
Email: info@standard-groups.com
4-Bromo-2-fluoroanisole Usage： Used in the synthesis of pharmaceutical intermediates 4-Bromo-2-fluoroanisole Packaging and Shipping： 200L/drum or as per buyer’s requirements 4-Bromo-2-fluoroanisole Storage: Storage in ventilated low temperature dry warehouse; Keep container closed and separately from open flame and heat source.
| Nama | 4-Bromo-2-fluoroanisole |
| Sinonim | 2-fluoro-4-bromoanisole 4-Bromo-2-fluoroanisole 2-FLUORO-4-BROMOANISOLE 4-BROMO-2-FLUOROANISOLE 4-Bromo-2-Fluoromethoxybenzene 1-BROMO-3-FLUORO-4-METHOXYBENZENE 4-Bromo-2-fluoro-1-methoxybenzene Benzene, 4-bromo-2-fluoro-1-methoxy- |
| CAS | 2357-52-0 |
| EINECS | 219-096-2 |
| InChI | InChI=1/C7H6BrFO/c1-10-7-3-2-5(8)4-6(7)9/h2-4H,1H3 |
| Rumus Molekuler | C7H6BrFO |
| Massa Molar | 205.02 |
| Kepadatan | 1.59 g/mL at 25 °C (lit.) |
| Titik Melting | 16 °C |
| Titik Boling | 84 °C/7 mmHg (lit.) |
| Titik Flash | 209°F |
| Kelarutan air | tidak dapat diselesaikan |
| Penampilan | clear liquid |
| Gravitasi Spesifik | 1.590 |
| warna | Colorless to Light yellow |
| BRN | 3240714 |
| Kondisi penyimpanan | Terkunci dalam kering,Suhu Kamar |
| Indeks Refraksi | n20/D 1.545(menyala.) |
| Sifat fisik dan kimia | Colorless transparent liquid. The relative density was 1.590. |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
