Chemical Name: 1-FluoronaphthaleneCAS No.:321-38-0Assay: ≥99% Appearance: Colorless to yellowish tra
Email: info@standard-groups.com
1-Fluoronaphthalene Usage： Used as pharmaceutical intermediate and Pesticide intermediate 1-Fluoronaphthalene Packaging and Shipping： 220KG/drum. 1-Fluoronaphthalene Storage: Keep container sealed and store in an ventilated, low temperature, dry warehouse, separate from foods and oxidizing agents.
| Nama | 1-fluoronaphthalene |
| Sinonim | NSC 4690 1-Fluornaftalen Fluoronaphthalene 1-fluoronaphthalene a-Fluoronaphthalene 1-fluoro-naphthalen 1-Fluoro naphthalene Duloxetine EP IMpurity G α-fluorinated naphthalene Duloxetine USP IMpurity G 1 - fluorinated naphthalene naphthyl fluoride C10H7F, α |
| CAS | 321-38-0 |
| EINECS | 206-287-0 |
| InChI | InChI=1/C12H9F/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
| InChIKey | CWLKTJOTWITYSI-UHFFFAOYSA-N |
| Rumus Molekuler | C10H7F |
| Massa Molar | 146.16 |
| Kepadatan | 1.1322 g/mL at 20 °C (lit.) |
| Titik Melting | -13 °C (lit.) |
| Titik Boling | 215 °C (lit.) |
| Titik Flash | 150°F |
| Kelarutan air | Not miscible or difficult to mix in water. |
| Solubilitas | slightly soluble in water, well soluble in chloroform, ethyl acetate, and methanol. |
| Tekanan Vapor | 0.0392mmHg at 25°C |
| Penampilan | Oil |
| Gravitasi Spesifik | 1.332 |
| warna | Colourless to Yellow |
| BRN | 1906413 |
| Kondisi penyimpanan | Terkunci dalam kering,Suhu Kamar |
| Stabilitas | Stabel. Tidak kompatibel dengan agen oksidasi kuat. |
| Indeks Refraksi | n20/D 1.593(lit.) |
| Sifat fisik dan kimia | Appearance: colorless transparent liquid |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
