Chemical Name:2-Fluorophenol CAS No.: 367-12-4 Assay: ≥99%Appearance:Colorless to light brown trans
Email: info@standard-groups.com
2-Fluorophenol Usage： Used as pharmaceutical intermediate and other organic synthetic intermediates 2-Fluorophenol Packaging and Shipping： 25kg/ drum or as per buyer requirement. 2-Fluorophenol Storage: Ventilated and dry; separate from alkalis, oxidisers, organic materials and flammable materials
| Nama | 2-Fluorophenol |
| Sinonim | 2-Florophenol 2-fluoro-pheno 2-Fluorophenol 2-FLUOROPHENOL 2-Hydroxyfluorobenzene 2-FLUOROHYDROXYBENZENE Adjacent fluorine phenol 1-Fluoro-2-hydroxybenzene Fluorophenolmincolorlessliq |
| CAS | 367-12-4 |
| EINECS | 206-681-2 |
| InChI | InChI=1/C6H5FO/c7-5-3-1-2-4-6(5)8/h1-4,8H |
| InChIKey | HFHFGHLXUCOHLN-UHFFFAOYSA-N |
| Rumus Molekuler | C6H5FO |
| Massa Molar | 112.1 |
| Kepadatan | 1.256 g/mL at 25 °C (lit.) |
| Titik Melting | 16.1 °C (lit.) |
| Titik Boling | 171-172 °C/741 mmHg (lit.) |
| Titik Flash | 116°F |
| Kelarutan air | 80.72g/L(25 ºC) |
| Solubilitas | 37.7g/l |
| Tekanan Vapor | 2.86mmHg at 25°C |
| Penampilan | Transparent liquid |
| Gravitasi Spesifik | 1.256 |
| warna | Clear colorless to light yellow-brownish |
| BRN | 1905112 |
| pKa | 8.73(at 25℃) |
| Kondisi penyimpanan | Atmosfer masuk, Suhu Kamar |
| Stabilitas | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Indeks Refraksi | n20/D 1.511(lit.) |
| MDL | MFCD00002155 |
| Sifat fisik dan kimia | Colorless transparent liquid, melting point 16.1 ℃, boiling point 171-172 ℃/741mmHg, Flash Point 46 ℃, specific gravity 1.256, refractive index 1.5140. |
| Penggunaan | Used as pesticide, pharmaceutical and dye intermediates |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
