Product NameBenzilMultiple NamesBenzil;Dibenzoyl;Diphenylethanedione;Melting Point Standard Benzil;1
Email:services@moutainchem.com
It is used as pharmaceutical intermediate, photosensitizer of UV curing resin, pharmaceutical raw material, organic synthesis intermediate, pesticide, photosensitizer, organic synthesis intermediate, adhesive, etc. Advantage of Benzil CAS No. 134-81-6 Soluble in ethanol, ether and other organic solvents It is optically active Stable, combustible, Incompatible with strong oxidizing agents.
| Nama | Benzil |
| Sinonim | Benzil BENZIL BIBENZOYL Dibenzoyl AURORA 14062 DIPHENYLGLYOXAL DIPHENYL DIKETONE Diphenylethanedione DIPHENYL-A B-DIKETONE 1,2-DIPHENYLETHANEDIONE 1,2-diphenylethane-1,2-dione 1,2-DIPHENYL-1,2 ETHANEDIONE Melting point standard benzil |
| CAS | 134-81-6 |
| EINECS | 205-157-0 |
| InChI | InChI=1/C14H10O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H |
| InChIKey | WURBFLDFSFBTLW-UHFFFAOYSA-N |
| Rumus Molekuler | C14H10O2 |
| Massa Molar | 210.23 |
| Kepadatan | 1,521 g/cm3 |
| Titik Melting | 94-95°C(lit.) |
| Titik Boling | 346 °C |
| Titik Flash | 346-348°C |
| Kelarutan air | 0.5 g/L (20 ºC) |
| Solubilitas | Soluble in alcohol, ether, chloroform, ethyl acetate, benzene, toluene and nitrobenzene, insoluble in water |
| Tekanan Vapor | 1 mm Hg ( 128.4 °C) |
| Penampilan | Yellow crystal or powder |
| warna | Putih |
| Merck | 14,1078 |
| BRN | 608047 |
| Kondisi penyimpanan | Simpan di bawah +30°C. |
| Stabilitas | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Sensitif | Sensitif untuk cahaya |
| Indeks Refraksi | 1.5681 (estimate) |
| MDL | MFCD00003080 |
| Sifat fisik dan kimia | Yellow crystals. Optically active. Density 1.23. Melting point 95 °c. Boiling point 346-348 °c (decomposition). Soluble in ethanol and ether, insoluble in water. Benzoin is generated during reduction. |
| Penggunaan | Used as pharmaceutical intermediates, UV curing resin photosensitizer |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
