Product NameAmmonium CarbamateMultiple NamesAmmonium Aminoformate;Carbamic Acid, Ammonium Salt;Carba
Email: info@standard-groups.com
It is a valuable ammoniating agent used in the production of fermentation promoters, electronic components, pharmaceuticals, pharmaceutical reagents, fermentation promoters, electronic components, etc. Analytical reagent and chemical reagent can be used as chromatographic analysis reagent and can be evolved into various carbonate products. Advantage of Ammonium Carbamate CAS No. 1111-78-0 Easy to store, stable product performance. It is widely used in the fermentation promoter product industry. It is widely used in the pharmaceutical intermediate industry.
| Nama | Ammonium carbamate |
| Sinonim | HSDB 485 UNII-I2W9615SWP Ammonium carbamate AMMONIUM CARBAMATE Ammonium carbaminate ammoniumaminoformate Ammonium aminoformate AMMONIUM CARBAMATE R. G. CARBAMIC ACID AMMONIUM SALT Carbamic acid, ammonium salt Carbamicacid,monoammoniumsalt Carbamic acid, monoammonium salt ''Anhydride'' of ammonium carbonate |
| CAS | 1111-78-0 |
| EINECS | 214-185-2 |
| InChI | InChI=1/CH3NO2.H3N/c2-1(3)4;/h2H2,(H,3,4);1H3 |
| InChIKey | BVCZEBOGSOYJJT-UHFFFAOYSA-N |
| Rumus Molekuler | CH6N2O2 |
| Massa Molar | 78.07 |
| Kepadatan | 1,6 g/cm3 |
| Titik Melting | 59-61°C (subl.) |
| Titik Boling | 58.76°C (estimate) |
| Titik Flash | 105,6°C |
| Kelarutan air | Soluble in cold water and ammonium hydroxide. Slightly soluble in alcohol. Insoluble in acetone. |
| Solubilitas | 790g/l |
| Tekanan Vapor | 100 mm Hg ( 26.7 °C) |
| Penampilan | Bubuk |
| warna | Putih |
| Merck | 14,507 |
| BRN | 3914091 |
| PH | 10 (100g/l, H2O, 20℃) |
| Kondisi penyimpanan | 2-8°C |
| Stabilitas | Stable, but may be moisture sensitive. Incompatible with strong oxidizing agents, strong acids, strong bases. |
| Batas ledakan | 2% |
| Indeks Refraksi | 1.4616 (estimate) |
| Penggunaan | Used as aluminum phosphide intermediate, also used in medicine |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
