Product Name4-Benzoylbiphenyl4-Multiple NamesBenzoylbiphenyl;(1,1-Biphenyl)-4-Yl)Phenylmethanone;5-P
Email: info@standard-groups.com
UV-curable coatings and inks are important intermediates for the synthesis of bifonazole and photosensitizers for photosensitive resins. Intermediate of antifungal drug bifonazole. Advantage of 4-Benzoylbiphenyl CAS No. 2128-93-0 It is no harm It can prevent hydrogen peroxide from being damaged by catalysiser It is wided used and accept by market
| Nama | 4-Benzoylbiphenyl |
| Sinonim | 4-Benzoylbiphenyl Photoinitiator-PBZ 4-Phenybenzophenone P-PHENYLBENZOPHENONE 4-Phenylbenzophenone 4-PHENYLBENZOPHENONE 4-Phenyl benzopehone 4-Phenyl Benzophenone LABOTEST-BB LT00159468 4-biphenylylphenylketone 4-Diphenyl phenyl ketone 4-Biphenylyl phenyl ketone biphenyl-4-yl(phenyl)methanone (1,1'-biphenyl)-4-ylphenyl-methanon [1,1'-biphenyl]-4-ylphenyl-methanon [1,1'-biphenyl]-4-ylphenyl-Methanone ((1,1-Biphenyl)-4-yl)phenylmethanone ((1,1'-Biphenyl)-4-yl)phenylmethanone 4-Benzoylbiphenyl[1,1'-biphenyl]-4-ylphenyl-Methanone |
| CAS | 2128-93-0 |
| EINECS | 218-345-2 |
| InChI | InChI=1/C19H14O/c20-19(17-9-5-2-6-10-17)18-13-11-16(12-14-18)15-7-3-1-4-8-15/h1-14H |
| InChIKey | LYXOWKPVTCPORE-UHFFFAOYSA-N |
| Rumus Molekuler | C19H14O |
| Massa Molar | 258.31 |
| Kepadatan | 1.0651 (rough estimate) |
| Titik Melting | 99-101°C(lit.) |
| Titik Boling | 419-420°C(lit.) |
| Titik Flash | 184.3°C |
| Kelarutan air | 73.6μg/L at 20℃ |
| Solubilitas | Chloroform (Slightly), Methanol (Slightly, Heated) |
| Tekanan Vapor | 0Pa pada 20 |
| Penampilan | grayish crystalline powder |
| warna | Putih untuk Off-White |
| BRN | 1876092 |
| Kondisi penyimpanan | Terkunci dalam kering,Suhu Kamar |
| Indeks Refraksi | 1.5500 (estimate) |
| MDL | MFCD00003079 |
| Sifat fisik dan kimia | Melting point 99-103°C crystalline compound. |
| Penggunaan | Used as pharmaceutical intermediates and photoinitiator |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
