Product Name3-Hydroxybenzoic AcidMultiple Names3-Hydroxybenzoic Acid;3-Carboxyphenol;4-27-00-07537 (
Email: info@standard-groups.com
It can be used as bactericide, coating, preservative, ion exchange agent, plasticizer and pharmaceutical intermediate, and can also be used to synthesize azo dyes, etc. Advantage of 3-Hydroxybenzoic Acid CAS No. 99-06-9 It is high security Good effect in the related use Easy to stock
| Nama | 3-Hydroxybenzoic acid |
| Sinonim | m-Hba NSC 55746 AI3-03110 BRN 0508160 m-salicylicacid 3-Carboxyphenol m-Salicylic acid EINECS 202-726-5 3-hydroxybenzoate m-hydroxy-benzoicaci 3-Hydroxybenzoic Acid m-Hydroxybenzoic acid 3-Hydroxybenzoic acid Acido m-idrossibenzoico Benzoic acid, 3-hydroxy- Benzoic acid, m-hydroxy- meta-Hydroxybenzoic acid kyselina3-hydroxybenzoova Kyselina 3-hydroxybenzoova Acido m-idrossibenzoico [Italian] Kyselina 3-hydroxybenzoova [Czech] m-HydroxybenzoicacidM-HydroxybenzoicAcid m-Hydroxybenzoic Acid 3-Hydroxybenzoic Acid 4-27-00-07537 (Beilstein Handbook Reference) |
| CAS | 99-06-9 |
| EINECS | 202-726-5 |
| InChI | InChI=1/C7H6O3/c8-6-3-1-2-5(4-6)7(9)10/h1-4,8H,(H,9,10)/p-1 |
| InChIKey | IJFXRHURBJZNAO-UHFFFAOYSA-N |
| Rumus Molekuler | C7H6O3 |
| Massa Molar | 138.12 |
| Kepadatan | 1.4850 |
| Titik Melting | 200-203 °C (lit.) |
| Titik Boling | 213.5°C (rough estimate) |
| Titik Flash | 220 °C |
| Kelarutan air | slightly soluble |
| Solubilitas | Soluble in hot water, soluble in ethanol and ether, slightly soluble in cold water, insoluble in benzene. |
| Tekanan Vapor | 2.24E-05mmHg at 25°C |
| Penampilan | kristal putih |
| warna | Putih hingga putih-off |
| BRN | 508160 |
| pKa | 4.06(at 19℃) |
| PH | 3 (H2O)Aqueous solution |
| Storage Condit | |
| Sensitif | Sensitif untuk cahaya |
| Indeks Refraksi | 1.4600 (estimate) |
| MDL | MFCD00002506 |
| Sifat fisik dan kimia | Appearance colorless crystals solubility slightly soluble in water and benzene, soluble in ethanol and n-butanol |
| Penggunaan | Used in the preparation of herbicides, fungicides, preservatives, ion exchangers, plasticizers and pharmaceutical intermediates, can also be used to synthesize azo dyes |
| Caution | Corrosive, pay attention to protection. Splash onto the skin and rinse with plenty of soapy water. |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
