In proteomics, the alkylation reagent of histidine and cysteine, used for peptide sequencing and enz
Email: info@standard-groups.com
Advantage of 2-Iodoacetamide CAS No. 144-48-9 The color is pure and free of impurities. The transportation conditions are simple. Easy storage and stable performance.
| Nama | Iodoacetamide |
| Sinonim | Surauto usafd-1 USAF d-1 2-Iodacetamid Iodoacetamide 2-iodo-acetamid 2-Iodoacetamide 2-Iodoacétamide Monoiodoacetamide Acetamide, 2-iodo- Iodiacetamide[IAM] |
| CAS | 144-48-9 |
| EINECS | 205-630-1 |
| InChI | InChI=1/C2H4INO/c3-1-2(4)5/h1H2,(H2,4,5) |
| InChIKey | PGLTVOMIXTUURA-UHFFFAOYSA-N |
| Rumus Molekuler | C2H4INO |
| Massa Molar | 184.96 |
| Kepadatan | 2.1103 (estimate) |
| Titik Melting | 92-95°C(lit.) |
| Titik Boling | 297.1±23.0 °C(Predicted) |
| Kelarutan air | H2O: 0.5M at 20°C, clear, colorless |
| Solubilitas | Soluble in hot water, easily soluble in ethanol. |
| Penampilan | Bubuk kristal putih |
| warna | White to pale yellow or beige |
| BRN | 1739080 |
| pKa | 15.16±0.40(Predicted) |
| Kondisi penyimpanan | 2-8°C |
| Stabilitas | Stable, but light sensitive. Incompatible with strong oxidizing agents, strong bases, reducing agents, acids. |
| Sensitif | Sensitif Cahaya |
| MDL | MFCD00008028 |
| Sifat fisik dan kimia | White crystals. Melting point 95 °c. Soluble in hot water, soluble in ethanol. |
| Penggunaan | Untuk sintesis organik |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
