Organic synthesis intermediates, used for dyes, pharmaceuticals and other fine chemical intermediate
Email: info@standard-groups.com
Advantage of 2-Chlorobenzonitrile CAS No. 873-32-5 It is widely used in the pharmaceutical industry. Fine chemical intermediates in dye industry. Stable performance and easy storage.
Organic synthesis intermediates, used for dyes, pharmaceuticals and other fine chemical intermediates.
Nama Produk
2-Chlorobenzonitrile
Nama berbilang
OCBN;
O-Chlorobenzonitrile
CAS No. 873-32-5
EC No. 212-836-5
MF No. C7H4ClN
MW No. 137.5664
| Nama | 2-Chlorobenzonitrile |
| Sinonim | OCBN 2 Chlorobenzonitrile 2-Chlorobenzonitrile o-chlorobenzonitrile |
| CAS | 873-32-5 |
| EINECS | 212-836-5 |
| InChI | InChI=1/C7H4ClN/c8-7-4-2-1-3-6(7)5-9/h1-4H |
| Rumus Molekuler | C7H4ClN |
| Massa Molar | 137.57 |
| Kepadatan | 1.23g/cm3 |
| Titik Melting | 43-46℃ |
| Titik Boling | 232.8°C at 760 mmHg |
| Titik Flash | 100.8°C |
| Solubilitas | Soluble in ether and ethanol. |
| Tekanan Vapor | 0.0577mmHg at 25°C |
| Penampilan | Needle crystal |
| Kondisi penyimpanan | Suhu Kamar |
| Indeks Refraksi | 1.563 |
| MDL | MFCD00001779 |
| Penggunaan | For dyes, pharmaceuticals and other fine chemical intermediates |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
