It is used to produce cyclopentadiene pesticide and unsaturated polyester resin. It can be used for
Email:services@moutainchem.com
Advantage of 2,5-Norbornadiene CAS No. 121-46-0 It is high purity It is good effect in related use It is widely used in demand field
It is used to produce cyclopentadiene pesticide and unsaturated polyester resin. It can be used for the synthesis of optical storage materials.
Nama Produk
2,5-Norbornadiene
Nama berbilang
2,5-Norbornadiene;
Bicyclo[2.2.1]Hepta-2,5-Diene
CAS No. 121-46-0
EC No. 204-472-0
MF No. C7H8
MW No. 92.1384
| Nama | Bicyclo[2.2.1]hepta-2,5-diene |
| Sinonim | 2,5-Norbornadiene Bicycloheptadiene Bicyclo[2.2.1]hepta-2,5-diene (1s,4s)-Bbicyclo[2.2.1]hepta-2,5-diene Bicyclo[2.2.1]hepta-2,5-diene, stabilized Bicycol(2.2.1)hepta-2.5-diene (2.5-norbornadiene) |
| CAS | 121-46-0 |
| EINECS | 204-472-0 |
| InChI | InChI=1/C7H8/c1-2-7-4-3-6(1)5-7/h1-2H,3-5H2 |
| InChIKey | SJYNFBVQFBRSIB-UHFFFAOYSA-N |
| Rumus Molekuler | C7H8 |
| Massa Molar | 92.14 |
| Kepadatan | 0.906g/mLat 25°C(lit.) |
| Titik Melting | -20--19°C |
| Titik Boling | 89°C(lit.) |
| Titik Flash | 12°F |
| Kelarutan air | Immiscible with water. |
| Tekanan Vapor | 69 hPa (20 °C) |
| Penampilan | A liquid |
| warna | Tidak berwarna hingga hampir tidak berwarna |
| Panjang gelombang maksimum (λmax) | ['195nm(EtOH)(lit.)'] |
| BRN | 506224 |
| Kondisi penyimpanan | Simpan di bawah +30°C. |
| Batas ledakan | 1.6-6.3%(V) |
| Indeks Refraksi | n20/D 1.470(menyala.) |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
