2,4,6-Trimethyl-1,3-Phenylenediamine is a derivative of phenylenediamine that is used in the product
Email: info@standard-groups.com
Advantage of 2,4,6-Trimethyl-1,3-Phenylenediamine CAS No. 3102-70-3 Safe It generally has no effect on pregnant women Easy to storage
2,4,6-Trimethyl-1,3-Phenylenediamine is a derivative of phenylenediamine that is used in the production of polyurethane foam. It is a white crystalline solid with a melting point of 67-68°C and a molecular weight of 192.31 g/mol. It is soluble in most organic solvents such as acetone and insoluble in water. It has a pKa of 7.3 and is moderately toxic by ingestion and inhalation.
Nama Produk
2,4,6-Trimethyl-1,3-Phenylenediamine
Nama berbilang
2,4,6-Trimethyl-1,3-Phenylenediamine;
2,4-Diamino-1,3,5-Trimethylbenzene (Diaminomesitylene);
2,4-Mesitylenediamine;
2,4,6-Trimethyl-1,3-Benzenediamine;
2,4,6-Trimethylbenzene-1,3-Diamine;
2,4,6-Trimethyl-m-Phenylenediamine
CAS No. 3102-70-3
EC No. 221-456-9
MF No. C9H14N2
MW No. 150.2209
| Nama | 2,4,6-Trimethyl-m-phenylenediamine |
| Sinonim | 2,4-Mesitylenediamine 2,4-DIAMINOMESITYLENE 2,4,6-Trimethyl-m-phenylenediamine 2,4,6-TRIMETHYL-M-PHENYLENEDIAMINE 2,4,6-Trimethyl-1,3-benzenediamine 1,3-DIAMINO-2,4,6-TRIMETHYLBENZENE 2,4-DIAMINO-1,3,5-TRIMETHYLBENZENE 2,4,6-trimethylbenzene-1,3-diamine 2,4,6-Trimethyl-1,3-phenylenediamine 2,4-Diamino-1,3,5-trimethylbenzene (Diaminomesitylene) |
| CAS | 3102-70-3 |
| EINECS | 221-456-9 |
| InChI | InChI=1/C9H14N2/c1-5-4-6(2)9(11)7(3)8(5)10/h4H,10-11H2,1-3H3 |
| InChIKey | ZVDSMYGTJDFNHN-UHFFFAOYSA-N |
| Rumus Molekuler | C9H14N2 |
| Massa Molar | 150.22 |
| Kepadatan | 1.051±0.06 g/cm3(Predicted) |
| Titik Melting | 89-91°C(lit.) |
| Titik Boling | 297.7±35.0 °C(Predicted) |
| Titik Flash | 158.4°C |
| Kelarutan air | 22.7g/L at 20℃ |
| Solubilitas | DMSO (Sedikit), Metanol (Sedikit) |
| Tekanan Vapor | 0.009Pa at 20℃ |
| Penampilan | Kristalisasi |
| warna | Brown |
| BRN | 2717221 |
| pKa | 5.03±0.10(Predicted) |
| Kondisi penyimpanan | Simpan di tempat gelap, atmosfer inert, suhu kamar |
| Indeks Refraksi | 1.605 |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
