6-Nitro-1H-indazol-3-amine

6-Nitro-1H-indazol-3-amine - Names and Identifiers

Nama	6-Nitro-1H-indazol-3-amine
Sinonim	6-nitro-1H-indazol-3-amine 6-Nitro-1H-indazol-3-amine 1H-Indazol-3-amine, 6-nitro- 6-Nitro-1H-indazol-3-ylamine
CAS	1027259-01-3
InChI	InChI=1S/C7H6N4O2/c8-7-5-2-1-4(11(12)13)3-6(5)9-10-7/h1-3H,(H3,8,9,10)

6-Nitro-1H-indazol-3-amine - Physico-chemical Properties

Rumus Molekuler	C7H6N4O2
Massa Molar	178.15
Kepadatan	1.631±0.06 g/cm3(Predicted)
Titik Boling	485.2±25.0 °C(Predicted)
Titik Flash	247.3±23.2 °C
Tekanan Vapor	0.0±1.2 mmHg at 25°C
pKa	11.97±0.40(Predicted)
Kondisi penyimpanan	2-8°C(protect from light)
Indeks Refraksi	1.817

6-Nitro-1H-indazol-3-amine - Risk and Safety

Kode Risiko	20/21/22 - Berbahaya dengan menghirup, dalam kontak dengan kulit dan jika ditelan.
Deskripsi Keselamatan	S7/47 - S36/37 Pakai pakaian dan sarung tangan pelindung yang sesuai.
ID PBB	2811
Kode HS	29339900

6-Nitro-1H-indazol-3-amine - Introduction

6-Nitro-3-amino-1H-indazole is an organic compound whose chemical formula is C7H6N4O2.

The main properties of the compound include:
1. Appearance: 6-nitro-3-amino-1H-indazole is a yellow crystal.
2. melting point: its melting point is 187-189 degrees Celsius.
3. Solubility: The solubility in water is low, but it can be dissolved in organic solvents (such as ethanol, dimethylformamide, etc.).

The main uses of 6-nitro-3-amino-1H-indazole include:
1. military use: the compound is a high-energy explosive substance, often used as one of the components of explosives.
2. Chemical research: It is also widely used in the field of chemical research as a reagent for the synthesis of other organic compounds.

The method for preparing 6-nitro-3-amino-1H-indazole is mainly obtained by nitration reaction. One common method of preparation is to react 3-amino-1H-indazole with nitric acid to produce the desired product. The specific experimental operation should be carried out under suitable laboratory conditions, paying attention to personal protection and experimental safety.

Regarding safety information, 6-nitro-3-amino-1H-indazole is an explosive compound, so strict safety procedures must be followed during handling and storage. Avoid potential hazards such as fire, high temperature, friction and collision. At the same time, the guidelines for safe operation of the relevant chemicals should be followed and the safety regulations stipulated by the state and local regulations should be observed. Especially when conducting experiments and using, it is necessary to wear appropriate personal protective equipment, such as protective glasses, gloves and laboratory coats.