5-Bromo-8-methoxy-2-methylquinoline - Names and Identifiers
Nama | 5-Bromo-8-methoxy-2-methylquinoline
|
Sinonim | ZINC02534104 5-Bromo-8-methoxy-2-methylquinoline 5-Bromo-6-Methoxy-2-methylquinoline 5-bromo-8-methoxy-2-methyl-quinoline 5-BROMO-8-METHOXY-2-METHYL-QUINOLINE Quinoline, 5-bromo-8-methoxy-2-methyl-
|
CAS | 103862-55-1
|
InChI | InChI=1S/C11H10BrNO/c1-7-3-4-8-9(12)5-6-10(14-2)11(8)13-7/h3-6H,1-2H3 |
5-Bromo-8-methoxy-2-methylquinoline - Physico-chemical Properties
Rumus Molekuler | C11H10BrNO
|
Massa Molar | 252.11 |
Kepadatan | 1.455 |
Titik Melting | 114℃ |
Titik Boling | 341℃ |
Titik Flash | 160℃ |
pKa | 3.01±0.50(Predicted) |
Kondisi penyimpanan | Terkunci dalam kering,Suhu Kamar |
5-Bromo-8-methoxy-2-methylquinoline - Introduction
5-Bromo-8-methoxy-2-methylquinoline is an organic compound. Its molecular formula is C12H12BrNO, and the structural formula is as follows:
Br
|
OCH3
|
CH3
C
//
HN C
\
CH3
The following is a description of the properties, uses, preparation methods and safety information of the compound:
Alam:
1. Penampilan: Padat kristal putih.
2. Melting point: about 60-62°C.
3. Boiling point: about 211-212°C.
4. Solubility: limited solubility in water, soluble in organic solvents such as ethanol and dichloromethane.
Penggunaan:
1. 5-Bromo-8-methoxy-2-methylquinoline is often used as a pharmaceutical intermediate for the synthesis and research of other compounds.
2. It can be used to synthesize biologically active molecules, such as anti-tumor drugs.
Metode Persiapan:
There are many preparation methods of 5-bromo-8-methoxy-2-methylquinoline, one of which is a common method of synthesis through the following steps:
1. Methoxyacetic anhydride reacts with 2-methyl quinoline to generate 2-amino -8-methoxyquinoline.
2. reacting 2-amino -8-methoxyquinoline with bromoacetic acid to generate 5-bromo -8-methoxy -2-methyl quinoline.
Informasi Keselamatan:
1. 5-Bromo-8-methoxy-2-methylquinoline is an organic compound, which should be used in accordance with laboratory safety procedures.
2. The compound may be irritating to the eyes, skin and respiratory tract, and direct contact should be avoided.
3. during use or storage, it should be kept in a cool, dry, well-ventilated place, and avoid contact with flammable substances.
4. Waste should be disposed of according to local regulations and should not be inverted at will.
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.