Introduction1072-53-3 – Names and IdentifiersName1,3,2-dioxathiolane 2,2-dioxideSynonymsgl
Email: info@standard-groups.com
| Nama | 1,3,2-dioxathiolane 2,2-dioxide |
| Sinonim | glycolsulfate Ethylenesulfate 1,2-ETHYLENE SULFATE ethyleneglycol,cyclicsulfate 1,3,2-Dioxathiolane-2,2-Dioxide 1,3,2-dioxathiolane 2,2-dioxide 1,3,2-DIOXATHIOLANE 2,2-DIOXIDE 1,3,2-Dioxathiolane,2,2-dioxides 1,3,2-Dioxathiolan-2,2-oxide (DTD) |
| CAS | 1072-53-3 |
| EINECS | 600-809-4 |
| InChI | InChI=1/C2H4O4S/c3-7(4)5-1-2-6-7/h1-2H2 |
| InChIKey | ZPFAVCIQZKRBGF-UHFFFAOYSA-N |
| Rumus Molekuler | C2H4O4S |
| Massa Molar | 124.12 |
| Kepadatan | 1.604±0.06 g/cm3 (20 ºC 760 Torr) |
| Titik Melting | 95-97 °C (lit.) |
| Titik Boling | 231.1±7.0℃ (760 Torr) |
| Titik Flash | 93.5±18.2℃ |
| Solubilitas | Chloroform, Methanol |
| Tekanan Vapor | 0.91-1.7Pa at 20-25℃ |
| Penampilan | White to beige powder or crystal |
| warna | Putih untuk Off-White |
| Kondisi penyimpanan | 2-8°C |
| Indeks Refraksi | 1.5090 (estimate) |
| MDL | MFCD00221769 |
| Kode Risiko | 22 – Harmful if swallowed |
| WGK Jerman | 3 |
| RTECS | JH4800000 |
| Kode HS | 29209085 |
| LogP | -0.45 at 23℃ and pH1.4-1.7 |
| surface tension | 66.8mN/m at 1g/L and 20 ℃ |
| Penggunaan | As an additive for the electrolyte of a lithium ion battery, the additive has the function of suppressing the decrease of the initial capacity of the battery, increasing the initial discharge capacity, reducing the expansion of the battery after being placed at a high temperature, and improving the charging and discharging performance and the number of cycles of the battery. Hydroxyethylating reagents for organic synthesis synthesize drug intermediates. It can also be used as a raw material for synthesizing certain heterocyclic compounds for gelatin hardening, antihypertensive drugs and new double surfactants |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
