563-47-3 - Names and IdentifiersName3-Chloro-2-methylpropeneSynonymsMACclorurodimetallileMethal
Email: info@standard-groups.com
| Nama | 3-Chloro-2-methylpropene |
| Sinonim | MAC clorurodimetallile Methallyl Chloride Cloruro di metallile chloruredemethallyle 2-methylallyl chloride Chlorure de methallyle beta-Methallyl chloride beta-methylallylchloride 3-Chloro-2-methylpropene beta-Methylallyl chloride 3-Chloro-2-Methylpropylene chloruedemethallyle(french) 3-chloro-2-methylprop-1-ene chloruredemethallyle(french) |
| CAS | 563-47-3 |
| EINECS | 209-251-2 |
| InChI | InChI=1/C4H7Cl/c1-4(2)3-5/h1,3H2,2H3 |
| Rumus Molekuler | C4H7Cl |
| Massa Molar | 90.55 |
| Kepadatan | 0.925 g/mL at 20 °C (lit.) |
| Titik Melting | -80 °C (lit.) |
| Titik Boling | 71-72 °C (lit.) |
| Titik Flash | 9°F |
| Kelarutan air | 0.5 g/L (20 ºC) |
| Solubilitas | H2O: insoluble |
| Tekanan Vapor | 102 mm Hg ( 20 °C) |
| Densitas Vapor | 3.12 (vs air) |
| Penampilan | Liquid |
| warna | Clear |
| Merck | 14,2148 |
| BRN | 878160 |
| Kondisi penyimpanan | 2-8°C |
| Batas ledakan | 2.2-10.4%(V) |
| Indeks Refraksi | n20/D 1.427(lit.) |
| Sifat fisik dan kimia |
|
| Penggunaan | For the synthesis of acaricidal tin, sodium methallyl sulfonate, 3-chloro-2-methyl-epoxypropane |
| Kode Risiko | Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML R20/22 - Harmful by inhalation and if swallowed. R34 - Menyebabkan luka bakar Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML R51/53 - Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment. |
| Deskripsi Keselamatan | Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML S36/37/39 Pakai pakaian pelindung, sarung tangan dan perlindungan mata/wajah yang sesuai. S45 Jika terjadi kecelakaan atau jika Anda merasa tidak sehat, segera mintalah saran medis (tunjukkan label apabila mungkin). S61 - Hindari pelepasan ke lingkungan. Lihat instruksi khusus / lembar data keselamatan. [UNK] S26 - Jika kontak dengan mata, bilas segera dengan banyak air dan minta saran medis. |
| ID PBB | UN 2554 3/PG 2 |
| WGK Jerman | 2 |
| RTECS | UC8050000 |
| TSCA | Ya |
| Kode HS | 29032900 |
| Kelas Bahaya | 3 |
| Kelompok Kemasan | II |
| (IARC) carcinogen classification | 2B (Vol. 63, 115) 2018 |
| Penggunaan | 2-methyl-3-chloropropene, also known as methallyl chloride, is used to synthesize the mite agent phenobylbutylbenzene, an intermediate chlorotert-butylbenzene, It can also be used to synthesize the intermediate furan of the insecticide carbofuran. this product is an important organic intermediate, which can be widely used in medicine, pesticide, perfume, synthetic materials and other fields. It is the main raw material for the synthesis of insecticides such as carbofuran and phenylbutyltin. Organic intermediates are the main raw materials for the synthesis of insecticides such as carbofuran and phenylbutyltin. Used as an intermediate for pesticides, plastics, medicines, etc. Used to synthesize acaricidal tin, sodium methallyl sulfonate, 3-chloro-2-methylpropylene oxide, etc. |
| Metode produksi | 2-methyl-3-chloropropene is prepared by the reaction of isobutylene and liquid chlorine. Isobutylene and liquid chlorine are measured separately after gasification, and then passed into the reactor according to the appropriate ratio. The reaction is strongly exothermic, and the reaction contact time must be strictly controlled, and the reaction is evenly mixed in an instant. After the reaction, the material enters the reaction evaporator, removes the reaction heat, and then enters the absorption condenser, absorbs hydrogen chloride into hydrochloric acid, and then is cooled and separated by oleic acid. Hydrochloric acid can be sold as a by-product, and the organic layer is fractionated to obtain 2-Methyl -3-chloropropene, the content can reach 95% ~ 98%. |
| kategori | flammable liquid |
| toxicity classification | poisoning |
| acute toxicity | oral administration-rat LD50: 848 mg/kg; Oral administration-mouse LDL0: 3160 mg/kg |
| Explosive hazard characteristics | Mix with air to form an explosive mixture; |
| karakteristik bahaya kebakaran | flammability; thermal decomposition of toxic chloride gas |
| karakteristik penyimpanan dan transportasi | warehouse ventilation and low temperature drying; separate from oxidant storage and transportation |
| fire extinguishing agent | foam, dry powder, carbon dioxide, sand |
| occupational standard | STEL 0.3 mg/m3 |
| auto-ignition temperature | 899 °F |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
