99-04-7 - Names and IdentifiersNamem-Toluic acidSynonymsm-Toluic acid3-TOLUIC ACIDM-TOLUIC ACID
Email: info@standard-groups.com
| Nama | m-Toluic acid |
| Sinonim | m-Toluic acid 3-TOLUIC ACID M-TOLUIC ACID 3-Toluic acid M-TOLUYLIC ACID m-toluylic acid 3-methylbenzoate m-Methylbenzoate RARECHEM AL BO 0048 3-METHYLBENZOIC ACID M-METHYLBENZOIC ACID m-methylbenzoic acid METHYLBENZOIC(M-) ACID beta-methylbenzoic acid beta-methylbenzoic acid |
| CAS | 99-04-7 |
| EINECS | 202-723-9 |
| InChI | InChI=1/C8H8O2/c1-6-3-2-4-7(5-6)8(9)10/h2-5H,1H3,(H,9,10)/p-1 |
| InChIKey | GPSDUZXPYCFOSQ-UHFFFAOYSA-N |
| Rumus Molekuler | C8H8O2 |
| Massa Molar | 136.15 |
| Kepadatan | 1.054 g/mL at 25 °C (lit.) |
| Titik Melting | 107-113 °C (lit.) |
| Titik Boling | 263 °C (lit.) |
| Titik Flash | 150 °C |
| Kelarutan air | <0.1 g/100 mL at 19 ºC |
| Solubilitas | Soluble in ethanol and ether, soluble in 60 parts of boiling water, soluble in 1170 parts of water at 15 ℃. |
| Tekanan Vapor | 0.019Pa at 25℃ |
| Penampilan | Pale yellow crystal |
| warna | Slightly yellow to beige-yellow |
| Merck | 14,9535 |
| BRN | 970526 |
| pKa | 4.27(at 25℃) |
| PH | 3.69(1 mM solution);3.15(10 mM solution);2.64(100 mM solution); |
| Kondisi penyimpanan | Simpan di bawah +30°C. |
| Stabilitas | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Sensitif | Mudah menyerap kelembapan |
| Indeks Refraksi | 1.509 |
| MDL | MFCD00002523 |
| Sifat fisik dan kimia | Character white or yellow crystals. melting point 111~113 ℃ boiling point 263 ℃ relative density 1.054g/cm3 refractive index 1.509 solubility is almost insoluble in water, slightly soluble in boiling water, soluble in ethanol, ether. |
| Penggunaan | Mainly used for the production of high-efficiency mosquito repellent, N,N-diethyl-m-toluamide, M-toluoyl chloride, M-toluonitrile, etc |
| Simbol Bahaya | Xn - Berbahaya |
| Kode Risiko | 22 - Sakit jika ditelan |
| Deskripsi Keselamatan | Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML S24/25 Hindari kontak dengan kulit dan mata. S36 - Pakai pakaian pelindung yang sesuai. |
| WGK Jerman | 3 |
| RTECS | XU1200000 |
| TSCA | Ya |
| Kode HS | 29163900 |
| Toksitas | LD50 orally in Rabbit: 7000 mg/kg |
Easy to sublimate. Low toxicity, half lethal dose (rat, oral)>3200mg/kg. Solubility in water: 1g/l (20°C)
| LogP | 2.37 |
| Aplikasi | mainly used for the production of high-efficiency mosquito repellent, N,N-diethyl-m-toluamide, M-toluoyl chloride, it can be used as an intermediate of drug toluene diethylamine. It is also used in the production of pesticides and other chemical products. It is used in organic synthesis intermediates, pesticide industry to prepare fungicide phosphoramide, and can also be used in spices and film. |
| metode produksi | is derived from the catalytic oxidation of M-xylene. Using cobalt epoxide as catalyst, M-Xylene is oxidized by air at a temperature of 125-135 ℃ and a pressure of about 0.25MPa. Consumption of M-xylene 1700kg per ton of product. |
| autoignition temperature | 500°C |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
