616-38-6 - Names and IdentifiersNameDimethyl carbonateSynonymsDMCMethyl carbonateMETHYL CARBONA
Email: info@standard-groups.com
| Nama | Dimethyl carbonate |
| Sinonim | DMC Methyl carbonate METHYL CARBONATE dimetyl carbonate DIMETHYL CARBONATE Dimethyl carbonate methylcarbonate((meo)2co) Carbonic acid dimethyl ester CARBONIC ACID DIMETHYL ESTER DIMETHYL CARBONATE, ANHYDROUS DimethylCarbonateForSynthesis DIMETHYL CARBONATE, REAGENTPLUS |
| CAS | 616-38-6 |
| EINECS | 210-478-4 |
| InChI | InChI=1/C3H6O3/c1-5-3(4)6-2/h1-2H3 |
| InChIKey | IEJIGPNLZYLLBP-UHFFFAOYSA-N |
| Rumus Molekuler | C3H6O3 |
| Massa Molar | 90.08 |
| Kepadatan | 1.069 g/mL at 25 °C (lit.) |
| Titik Melting | 2-4 °C (lit.) |
| Titik Boling | 90 °C (lit.) |
| Titik Flash | 65°F |
| Kelarutan air | 139 g/L |
| Solubilitas | 139g/l |
| Tekanan Vapor | 18 mm Hg ( 21.1 °C) |
| Densitas Vapor | 3.1 (vs air) |
| Penampilan | Liquid |
| warna | <50(APHA) |
| Bau | Pleasant |
| Merck | 14.3241 |
| BRN | 635821 |
| Kondisi penyimpanan | Simpan di bawah +30°C. |
| Stabilitas | Stable. Highly flammable. Incompatible with strong oxidizing agents, potassium t-butoxide. |
| Sensitif | Kekerasan Sensitif |
| Batas ledakan | 4.22-12.87%(V) |
| Indeks Refraksi | n20/D 1.368(lit.) |
| Sifat fisik dan kimia | Characteristics of colorless transparent liquid, irritating odor. properties is an important organic synthesis intermediates, molecular structure containing carbonyl, methyl and methoxy functional groups, with a variety of reaction properties, in the production of safe and convenient, characteristics of less pollution and easy transportation |
| Penggunaan | Used in chemical synthesis of methylating agent and carbonylating agent, widely used in food antioxidants, plant protection agents and other fields |
| Simbol Bahaya | F - Flammable |
| Kode Risiko | 11 - Highly Flammable |
| Deskripsi Keselamatan | Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML S2017/9/16 - |
| ID PBB | UN 1161 3/PG 2 |
| WGK Jerman | 1 |
| RTECS | FG0450000 |
| TSCA | Ya |
| Kode HS | 2920 90 10 |
| Kelas Bahaya | 3 |
| Kelompok Kemasan | II |
| Toksitas | LD50 in rats (g/kg): 13.8 orally; 2.5 dermally; LC50 (4 hr) in rats (mg/l): 140 by inhalation (Ono) |
| Material Raw | Propylene oxide Methyl alcohol Propylene carbonate |
| Downstream Products | Diethyl carbonate Methyl ethyl carbonate asulam Ciprofloxacin |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
