5495-84-1 - Names and IdentifiersName2-IsopropylthioxanthoneSynonymsITXPhotocure-ItxSPEEDCURE I
Email: info@standard-groups.com
| Nama | 2-Isopropylthioxanthone |
| Sinonim | ITX Photocure-Itx SPEEDCURE ITX QUANTACURE ITX SPEEDCURE 2-ITX 2-(1-Methylethyl)- Photoinitiator ITX Isopropylthioxanthone 2-Isopropylthioxanthon 2-Isoproprlthioxanthone 2-Isopropylthioxanthone 2-Isopropylthioxanthen-9-one 2-Isopropyl-9H-thioxanthen-9-one 2-(propan-2-yl)-9H-thioxanthen-9-one Isopropyl Thioxanthone (Mixture of 2 IsoMers and 4 IsoMers) |
| CAS | 5495-84-1 |
| EINECS | 226-827-9 |
| InChI | InChI=1/C16H14OS/c1-10(2)11-7-8-15-13(9-11)16(17)12-5-3-4-6-14(12)18-15/h3-10H,1-2H3 |
| InChIKey | KTALPKYXQZGAEG-UHFFFAOYSA-N |
| Rumus Molekuler | C16H14OS |
| Massa Molar | 254.35 |
| Kepadatan | 1,199±0,06 g/cm3(Diperkirakan) |
| Titik Melting | 76 °C |
| Titik Boling | 398.9±32.0 °C(Predicted) |
| Titik Flash | 210°C |
| Kelarutan air | 340μg/L at 20℃ |
| Solubilitas | Solubility is general and effective at low concentrations. |
| Tekanan Vapor | 0Pa pada 20 |
| Penampilan | Slightly yellow crystalline powder |
| warna | Pale Yellow to Light Yellow |
| Kondisi penyimpanan | Tetap di tempat gelap, Terkunci di tempat kering, Suhu Kamar |
| Sensitif | Sensitif untuk cahaya |
| Indeks Refraksi | 1.638 |
| MDL | MFCD00055658 |
| Sifat fisik dan kimia | Solid, yellow, generally soluble, effective at low concentrations. Absorption wavelength of 250 ~ 400nm. |
| Penggunaan | Photoinitiators for UV-curing coatings |
| Simbol Bahaya | Xn - Berbahaya |
| Kode Risiko | 22 - Sakit jika ditelan |
| Deskripsi Keselamatan | S20/21 - S58 - |
| WGK Jerman | 3 |
| Kode HS | 29349990 |
| LogP | 5.59 at 20℃ |
| menggunakan | efficient UV curing initiator. UV curable coatings and inks; used as photoinitiator for UV curable coatings; used as photoinitiator used as photoinitiator for UV curable coatings Penutup dan tinta UV yang bisa disembuhkan |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
