89-65-6 - Names and IdentifiersNameD-Isoascorbic acidSynonymsFEMA 2410Isovitamin CISOVITAMIN CE
Email: info@standard-groups.com
| Nama | D-Isoascorbic acid |
| Sinonim | FEMA 2410 Isovitamin C ISOVITAMIN C Acid eritorbik ISOASCORBIC ACID araboascorbicacid D-Isoascorbic acid D-Araboascorbic acid d-arabino-ascorbicacid d-erythro-3-ketohexonicacidlactone 3-keto-d-erythro-hexonicacigamma-lactone 2,3-didehydro-d-erythro-hexono-1,4-lactone D-erythro-Hex-2-enonic acid, gamma-lactone (5R)-5-(1,2-dihydroxyethyl)-3,4-dihydroxy-5-methyl-furan-2-one |
| CAS | 89-65-6 |
| EINECS | 201-928-0 |
| InChI | InChI=1/C7H10O6/c1-7(3(9)2-8)5(11)4(10)6(12)13-7/h3,8-11H,2H2,1H3/t3?,7-/m1/s1 |
| InChIKey | CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
| Rumus Molekuler | C6H8O6 |
| Massa Molar | 176.12 |
| Kepadatan | 1.3744 (rough estimate) |
| Titik Melting | 169-172 °C (dec.) (lit.) |
| Titik Boling | 227.71°C (rough estimate) |
| Rotasi Spesifik( α) | -17.25 º (c=10, H2O 25 ºC) |
| Titik Flash | 212.9°C |
| Kelarutan air | 1g/10mL |
| Solubilitas | Soluble in water, ethanol and pyridine, soluble in acetone, slightly soluble in glycerin, insoluble in ether and benzene. |
| Tekanan Vapor | 0Pa pada 25 |
| Penampilan | Kristalisasi |
| warna | White to slightly yellow |
| Merck | 14,5126 |
| BRN | 84271 |
| pKa | 4.09±0.10(Predicted) |
| Kondisi penyimpanan | 2-8°C |
| Stabilitas | Stable. Combustible. Incompatible with chemically active metals, aluminium, zinc, copper, magnesium, strong bases, strong oxidizing agents. |
| Sensitif | Sensitif untuk cahaya |
| Indeks Refraksi | -17.5 ° (C=10, H2O) |
| MDL | MFCD00005378 |
| Sifat fisik dan kimia | White to light yellow crystals or crystalline powder. Odorless, sour. Gradually blackened under light. In a dry state, it is quite stable in the air. But it deteriorates rapidly in solution and in the presence of air. Melted and decomposed at 164~172 ℃. This strain is an isomer of ascorbic acid, which is chemically similar to ascorbic acid, but has little physiological activity of ascorbic acid (only about 1/20). The oxidation resistance is better than ascorbic acid, the price is also cheaper, but the heat resistance is poor. It has strong reducibility, and slowly colors and decomposes when exposed to light. Heavy metal ions promote its decomposition. Easily soluble in water (40g/100 m1). Soluble in ethanol (5g/100ml). Insoluble in glycerin. Insoluble in ether and benzene. |
| Penggunaan | Used as a food antioxidant, with preservation, the role of quality |
| Simbol Bahaya | Xi - Irritasi |
| Kode Risiko | 36/37/38 - Irritasi pada mata, sistem pernapasan dan kulit. |
| Deskripsi Keselamatan | S26 - Jika kontak dengan mata, bilas segera dengan banyak air dan minta saran medis. S24/25 Hindari kontak dengan kulit dan mata. |
| WGK Jerman | 2 |
| RTECS | KF3015000 |
| TSCA | Ya |
| Kode HS | 29329990 |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
