64-19-7 - Names and IdentifiersNameAcetic acidSynonymsGAAAcetic acidEthanoic acidWIJS CHLORIDEW
Email: info@standard-groups.com
| Nama | Acetic acid |
| Sinonim | GAA Acetic acid Ethanoic acid WIJS CHLORIDE WIJS SOLUTION WIJS' SOLUTION Natural Acetic Acid Acetic Acid Glacial Glacial acetic acid Acetic Acid, Glacial Acetic Acid Glacial BP Natural Acetic Acid |
| CAS | 64-19-7 |
| EINECS | 200-580-7 |
| InChI | InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4) |
| Rumus Molekuler | C2H4O2 |
| Massa Molar | 60.05 |
| Kepadatan | 1.049 g/mL at 25 °C(lit.) |
| Titik Melting | 16.2°C(lit.) |
| Titik Boling | 117-118 °C(lit.) |
| Titik Flash | 104°F |
| Nomor JECFA | 81 |
| Kelarutan air | miscible |
| Solubilitas | alcohol: miscible(lit.) |
| Tekanan Vapor | 11.4 mm Hg ( 20 °C) |
| Densitas Vapor | 2.07 (vs air) |
| Penampilan | Solution |
| Gravitasi Spesifik | 1.0492 (20℃) |
| warna | tanpa warna |
| Bau | Strong, pungent, vinegar-like odor detectable at 0.2 to 1.0 ppm |
| Batas eksposisi | TLV-TWA 10 ppm ～25 mg/m3) (ACGIH,OSHA, and MSHA); TLV-STEL 15 ppm(37.5 mg/m3) (ACGIH). |
| Panjang gelombang maksimum (λmax) | ['λ: 260 nm Amax: 0.05', , 'λ: 270 nm Amax: 0.02', , 'λ: 300 nm Amax: 0.01', , 'λ: 50 |
| Merck | 14,55 |
| BRN | 506007 |
| pKa | 4.74(at 25℃) |
| PH | 3.91(1 mM solution);3.39(10 mM solution);2.88(100 mM solution); |
| Kondisi penyimpanan | Simpan di bawah +30°C. |
| Batas ledakan | 4-19.9%(V) |
| Indeks Refraksi | n20/D 1.371(lit.) |
| Sifat fisik dan kimia | Characteristics of colorless transparent liquid, irritating odor. melting point 16.635 ℃ boiling point 117.9 ℃ relative density 1.0492 refractive index 1.3716 flash point 57 ℃ solubility in water, ethanol, benzene and ether miscible, insoluble in carbon disulfide. |
| Penggunaan | Mainly used for the preparation of acetic anhydride, vinyl acetate, acetic acid esters, metal acetate, chloroacetic acid, cellulose acetate, used in the production of ethyl acetate, edible spices, wine spices used as analytical reagents, solvents and lotion |
| Kode Risiko | R34 - Menyebabkan luka bakar R42 - May cause sensitization by inhalation Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML R36/38 - Mengganggu mata dan kulit. |
| Deskripsi Keselamatan | S26 - Jika kontak dengan mata, bilas segera dengan banyak air dan minta saran medis. S36/37/39 Pakai pakaian pelindung, sarung tangan dan perlindungan mata/wajah yang sesuai. S45 Jika terjadi kecelakaan atau jika Anda merasa tidak sehat, segera mintalah saran medis (tunjukkan label apabila mungkin). S23 Jangan menghirup uap. S24/25 Hindari kontak dengan kulit dan mata. |
| ID PBB | UN 1792 8/PG 2 |
| WGK Jerman | 3 |
| RTECS | NN1650000 |
| FLUKA BRAND F KODE | 1-8-10 |
| TSCA | Ya |
| Kode HS | 29152100 |
| Kelas Bahaya | 8 |
| Kelompok Kemasan | II |
| Toksitas | LD50 in rats (g/kg): 3.53 orally (Smyth) |
| Material Raw | n-Butyric acid Methyl alcohol Oxygen Ethyl Alcohol Acetaldehyde Ethylene |
| Downstream Products | 2,3-Benzofuran 2-Amino-4-acetamino anisole Chloroacetic acid Isophthalic acid Glisin Triacetin 2-Ethoxyethyl acetate Ethyl acetate Vinyl acetate n-Butyl acetate Isopropyl acetate |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
