79-33-4 - Names and IdentifiersNameL(+)-Lactic acidSynonymsL-Lactic acidL(+)-Lactic acidL(+)-La
Email: info@standard-groups.com
| Nama | L(+)-Lactic acid |
| Sinonim | L-Lactic acid L(+)-Lactic acid L(+)-Lactic Acid SARCOLACTIC ACID (S)-(+)-LACTIC ACID 2-HYDROXYPROPIONIC ACID L-Lactic acid, free acid L(+)-Lactic acid solution L-2-HYDROXYPROPIONIC ACID (S)-2-HYDROXYPROPIONIC ACID (S)-2-Hydroxypropionic acid L-(+)-2-HYDROXYPROPANOIC ACID (S)-(+)-2-HYDROXYPROPANOIC ACID (S)-(+)-2-Hydroxypropanoic acid L(+)lactic acid free acid sigmaultra |
| CAS | 79-33-4 |
| EINECS | 201-196-2 |
| InChI | InChI=1/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m0/s1 |
| InChIKey | JVTAAEKCZFNVCJ-REOHCLBHSA-N |
| Rumus Molekuler | C3H6O3 |
| Massa Molar | 90.08 |
| Kepadatan | 1.206g/mLat 25°C |
| Titik Melting | 52-54°C |
| Titik Boling | 125 °C |
| Rotasi Spesifik( α) | -13.5 º (c=2.5, 1.5N NaOH) |
| Titik Flash | > 230°F |
| Nomor JECFA | 930 |
| Kelarutan air | SOLUBLE |
| Solubilitas | It can be mixed with water, ethanol or ether at will and is insoluble in chloroform. |
| Tekanan Vapor | 0.038Pa at 25℃ |
| Penampilan | Powder/Solid |
| warna | Putih |
| Merck | 14,5337 |
| BRN | 1720251 |
| pKa | pK at 25°, 3.79 |
| Kondisi penyimpanan | 2-8°C |
| Sensitif | Higroskopis |
| Indeks Refraksi | n20/D 1.427 |
| MDL | MFCD00064266 |
| Sifat fisik dan kimia | Colorless, clear, viscous liquid, slightly sour; Hygroscopicity, acidic reaction in aqueous solution. It can be mixed with water, ethanol or ether and is insoluble in chloroform. density 1.206 boiling point 125°C refractive index 1.426-1.428 specific optical rotation -13.5 ° (c = 2.5, 1.5N NaOH) water-SOLUBLE solution |
| Penggunaan | Mainly used as a food acid and preservatives, as well as for the manufacture of calcium lactate and other drugs |
| Kode Risiko | Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML R34 - Menyebabkan luka bakar R36/37/38 Irritasi pada mata, sistem pernapasan dan kulit. R36 - Irritating to the eyes Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML |
| Deskripsi Keselamatan | S26 - Jika kontak dengan mata, bilas segera dengan banyak air dan minta saran medis. Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML S45 Jika terjadi kecelakaan atau jika Anda merasa tidak sehat, segera mintalah saran medis (tunjukkan label apabila mungkin). S36/37/39 Pakai pakaian pelindung, sarung tangan dan perlindungan mata/wajah yang sesuai. S36 - Pakai pakaian pelindung yang sesuai. |
| ID PBB | 3261 |
| WGK Jerman | 1 |
| RTECS | OD2800000 |
| FLUKA BRAND F KODE | 3-10 |
| TSCA | Ya |
| Kode HS | 29181100 |
| Kelas Bahaya | 8 |
| Kelompok Kemasan | III |
| Toksitas | LD50 intraperitoneal in mouse: 3194mg/kg |
| Material Raw | Starch potato |
| Downstream Products | dl-lactic acid sodium salt Fenoxaprop-ethyl Ethyl (R)-2-[4-(6-chloroquinoxalin-2-yloxy)phenoxy]propionate Calcium lactate |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
