617-48-1 - Names and IdentifiersNameDL-Malic acidSynonymsC00711Malic acidDL-Malic acidMALIC ACI
Email: info@standard-groups.com
| Nama | DL-Malic acid |
| Sinonim | C00711 Malic acid DL-Malic acid MALIC ACID, DL- Malicacidpfelsure Musashi-no-Ringosan DL-Hydroxysuccinic acid 2-hydroxybutanedioic acid (2R)-2-hydroxybutanedioate |
| CAS | 617-48-1 6915-15-7 |
| EINECS | 210-514-9 |
| InChI | InChI=1/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/p-2/t2-/m1/s1 |
| Rumus Molekuler | C4H6O5 |
| Massa Molar | 134.09 |
| Kepadatan | 1,609 g/cm3 |
| Titik Melting | 131-133°C(lit.) |
| Titik Boling | 150℃[at 101 325 Pa] |
| Rotasi Spesifik( α) | [α]D20 -0.5～+0.5° (c=5, H2O) |
| Titik Flash | 203°C |
| Kelarutan air | 500g/L at 25℃ |
| Solubilitas | Soluble in water, alcohol, slightly soluble in ether, insoluble in benzene. |
| Tekanan Vapor | <0.1 mm Hg ( 20 °C) |
| Densitas Vapor | 4.6 (vs air) |
| Penampilan | White crystal or crystalline powder |
| warna | Putih untuk Off-White |
| pKa | pK1:3.458;pK2:5.097 (25°C) |
| Kondisi penyimpanan | Kulkas |
| Stabilitas | Stable. Incompatible with strong oxidizing agents, strong bases, amines, alkali metals, carbonates. |
| Sensitif | Sensitif untuk cahaya |
| MDL | MFCD00064212 |
| Sifat fisik dan kimia | Character malic acid is stable under normal conditions, and has hygroscopicity when humidity is high. Triclinic white crystals. melting point 130 ℃ relative density 1.601 soluble in methanol, ethanol, acetone and many other polar solvents. |
| Penggunaan | Food industry used as acidulants, color retention agents, preservatives and emulsion stabilizers such as egg yolk, also used in pharmaceutical |
| Simbol Bahaya | Xn - Berbahaya |
| Kode Risiko | Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML R37/38 - Mengganggu sistem respirasi dan kulit. Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML R42/43 - Mungkin menyebabkan sensitisasi melalui inhalasi dan kontak kulit. R34 - Menyebabkan luka bakar |
| Deskripsi Keselamatan | S26 - Jika kontak dengan mata, bilas segera dengan banyak air dan minta saran medis. Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML |
| WGK Jerman | 1 |
| RTECS | ON7175000 |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
