868-14-4 - Names and IdentifiersNamePotassium bitartrateSynonymsCream of tartarL(+)-Potassium h
Email: info@standard-groups.com
| Nama | Potassium bitartrate |
| Sinonim | Cream of tartar L(+)-Potassium hydro Potassium bitartrate Potassium Bitartarate Radix Notoginseng P.E. Potassium acid tartrate Acid potassium tartrate PotassiuM Bitartrate (AS) Potassium hydrogen tartrate Potassium Bitartrate, powder L(+)-Potassium Hydrogen Tartrate potassium 3-carboxy-2,3-dihydroxypropanoate potassium (2R,3R)-3-carboxy-2,3-dihydroxypropanoate Butanedioic acid, 2,3-dihydroxy-(R-(R*,R*))-, monopotassiu Potassium hydrogen L-tartrate Tartaric acid monopotassium salt L-(+)-Tartaric acid monopotassium salt, Potassium hydrogen L-tartrate L(+)-Tartaric acid monopotassium salt, Potassium L-tartrate monobasic, Potassium bitartrate, Potassium hydrogen L-tartrate, Tartaric acid monopotassium salt |
| CAS | 868-14-4 35-04-1 6381-58-4 |
| EINECS | 212-769-1 |
| InChI | InChI=1/C4H6O6.K/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+1/p-2 |
| Rumus Molekuler | C4H5KO6 |
| Massa Molar | 188.18 |
| Kepadatan | 1.954g/mLat 25°C(lit.) |
| Titik Melting | 267°C (dec.) |
| Titik Boling | 318℃[at 101 325 Pa] |
| Rotasi Spesifik( α) | 32.5 º (c=10, 1N NaOH) |
| Titik Flash | 210℃ |
| Kelarutan air | Soluble in water and dilute mineral acid. Insoluble in alcohol. |
| Solubilitas | 1g dissolved in 162ml of water, 16ml of boiling water and 8820ml of ethanol. Easily soluble in dilute mineral acid, alkali solution and borax solution, soluble in boiling water, slightly soluble in cold water, very slightly soluble in alcohol. |
| Tekanan Vapor | 30.69hPa at 25.2℃ |
| Penampilan | Bubuk kristal putih |
| Gravitasi Spesifik | 1.954 |
| warna | Colorless opaque or white |
| Bau | Odorless |
| Merck | 14,7615 |
| BRN | 6119985 |
| PH | 3.4-3.7 (H2O, 20℃)(saturated solution) |
| Kondisi penyimpanan | Atmosfer masuk, Suhu Kamar |
| Stabilitas | Stabel. Tidak kompatibel dengan agen oksidasi kuat. |
| Sensitif | Mudah menyerap kelembapan |
| MDL | MFCD00065392 |
| Sifat fisik dan kimia | Colorless or white crystalline powder. The relative density was 1.984. Soluble in dilute inorganic acid, alkali solution or borax solution. Insoluble in ethanol or acetic acid. Solubility in water. t,℃ 0 20 40 60 80 100KHC4H4O6,% 0.32 0.54 1.19 2.40 4.40 6.50 |
| Penggunaan | Used as Capacity Analysis, buffer, reducing agent and food industry leavening agent |
| Deskripsi Keselamatan | 24/25 - Avoid contact with skin and eyes. |
| WGK Jerman | 1 |
| RTECS | WW8223000 |
| TSCA | Ya |
| Kode HS | 29181300 |
| Material Raw | Hydrogen peroxide (2R,3R)-2,3-Dihydroxybernsteinsaeure Potassium hydroxide Maleic anhydride Potassium carbonate |
| Downstream Products | Potassium bitartrate |
Penafian: Konten di atas hanya untuk referensi dan komunikasi antara orang dalam industri, dan tidak menjamin akurasi atau kelengkapannya. Menurut hukum dan peraturan yang relevan dan peraturan situs web ini, unit atau individu yang membeli barang terkait harus memperoleh kualifikasi dan kondisi kualifikasi yang valid.
Telepon Perusahaan
+86-21-6420 0566
Jam kerja
Senin sampai Jumat
Telepon seluler:
13816217984
Email:
info@qinsun-lab.com
